C8H5NS4 — CID 125477531
(5Z)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dithione (PubChem CID 125477531) has the molecular formula C8H5NS4 and a molecular weight of 243.40 g/mol. Its IUPAC name is (5Z)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dithione.
| Compound Name | (5Z)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dithione |
|---|---|
| PubChem CID | 125477531 |
| Molecular Formula | C8H5NS4 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | (5Z)-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dithione |
| SMILES | S=C1NC(=S)/C(=C/c2cccs2)S1 |
| InChI | InChI=1S/C8H5NS4/c10-7-6(13-8(11)9-7)4-5-2-1-3-12-5/h1-4H,(H,9,10,11)/b6-4- |
| InChIKey | BPUBJAIGSOLZDQ-XQRVVYSFSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|