C18H25IO5 — CID 125479784
1-O-(3-ethoxypropyl) 3-O-pentan-3-yl 5-iodobenzene-1,3-dicarboxylate (PubChem CID 125479784) has the molecular formula C18H25IO5 and a molecular weight of 448.30 g/mol. Its IUPAC name is 1-O-(3-ethoxypropyl) 3-O-pentan-3-yl 5-iodobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-(3-ethoxypropyl) 3-O-pentan-3-yl 5-iodobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 125479784 |
| Molecular Formula | C18H25IO5 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 1-O-(3-ethoxypropyl) 3-O-pentan-3-yl 5-iodobenzene-1,3-dicarboxylate |
| SMILES | CCOCCCOC(=O)c1cc(I)cc(C(=O)OC(CC)CC)c1 |
| InChI | InChI=1S/C18H25IO5/c1-4-16(5-2)24-18(21)14-10-13(11-15(19)12-14)17(20)23-9-7-8-22-6-3/h10-12,16H,4-9H2,1-3H3 |
| InChIKey | NXNOCDUXHGWQKD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|