C14H15FO2 — CID 125479846
1-cyclobutyl-4-(4-fluorophenyl)butane-1,4-dione (PubChem CID 125479846) has the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. Its IUPAC name is 1-cyclobutyl-4-(4-fluorophenyl)butane-1,4-dione.
| Compound Name | 1-cyclobutyl-4-(4-fluorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 125479846 |
| Molecular Formula | C14H15FO2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-cyclobutyl-4-(4-fluorophenyl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)C1CCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FO2/c15-12-6-4-11(5-7-12)14(17)9-8-13(16)10-2-1-3-10/h4-7,10H,1-3,8-9H2 |
| InChIKey | LHNXUFHUTFZOKH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |