C11H7N3O3 — CID 125480221
(2-buta-1,3-diynyl-4-nitrophenyl)urea (PubChem CID 125480221) has the molecular formula C11H7N3O3 and a molecular weight of 229.20 g/mol. Its IUPAC name is (2-buta-1,3-diynyl-4-nitrophenyl)urea.
| Compound Name | (2-buta-1,3-diynyl-4-nitrophenyl)urea |
|---|---|
| PubChem CID | 125480221 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (2-buta-1,3-diynyl-4-nitrophenyl)urea |
| SMILES | C#CC#Cc1cc([N+](=O)[O-])ccc1NC(N)=O |
| InChI | InChI=1S/C11H7N3O3/c1-2-3-4-8-7-9(14(16)17)5-6-10(8)13-11(12)15/h1,5-7H,(H3,12,13,15) |
| InChIKey | QRXVCKVUNVGISL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|