C13H13IN4O2 — CID 125481278
(6S)-6-hydroxy-1-(4-iodo-2-pyridinyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 125481278) has the molecular formula C13H13IN4O2 and a molecular weight of 384.18 g/mol. Its IUPAC name is (6S)-6-hydroxy-1-(4-iodo-2-pyridinyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (6S)-6-hydroxy-1-(4-iodo-2-pyridinyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 125481278 |
| Molecular Formula | C13H13IN4O2 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (6S)-6-hydroxy-1-(4-iodo-2-pyridinyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2cc(I)ccn2)c2c1CC[C@H](O)C2 |
| InChI | InChI=1S/C13H13IN4O2/c14-7-3-4-16-11(5-7)18-10-6-8(19)1-2-9(10)12(17-18)13(15)20/h3-5,8,19H,1-2,6H2,(H2,15,20)/t8-/m0/s1 |
| InChIKey | NVSLAGSYVMENGJ-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|