C15H21NO — CID 125481439
N-butyl-2-(2,3-dihydro-1H-inden-2-yl)acetamide (PubChem CID 125481439) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is N-butyl-2-(2,3-dihydro-1H-inden-2-yl)acetamide.
| Compound Name | N-butyl-2-(2,3-dihydro-1H-inden-2-yl)acetamide |
|---|---|
| PubChem CID | 125481439 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-butyl-2-(2,3-dihydro-1H-inden-2-yl)acetamide |
| SMILES | CCCCNC(=O)CC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO/c1-2-3-8-16-15(17)11-12-9-13-6-4-5-7-14(13)10-12/h4-7,12H,2-3,8-11H2,1H3,(H,16,17) |
| InChIKey | CBBRWGBAIDSRKR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|