About N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine
N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine (PubChem CID 125481673) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine.
Molecular Properties
| Compound Name | N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine |
| PubChem CID | 125481673 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine |
| SMILES | CCCCN(C)C[C@H]1Cc2ccccc2[C@H]1C |
| InChI | InChI=1S/C16H25N/c1-4-5-10-17(3)12-15-11-14-8-6-7-9-16(14)13(15)2/h6-9,13,15H,4-5,10-12H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | KCRXIULQRVVJRI-DZGCQCFKSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine?
The IUPAC name of N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine (CID 125481673) is N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine.
What is the SMILES notation for N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine?
The canonical SMILES for N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine is CCCCN(C)C[C@H]1Cc2ccccc2[C@H]1C.
What is the InChIKey of N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine?
The InChIKey is KCRXIULQRVVJRI-DZGCQCFKSA-N. The full InChI is InChI=1S/C16H25N/c1-4-5-10-17(3)12-15-11-14-8-6-7-9-16(14)13(15)2/h6-9,13,15H,4-5,10-12H2,1-3H3/t13-,15+/m0/s1.
What are the key properties of N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine?
N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine has a molecular weight of 231.38 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]methyl]butan-1-amine is sourced from PubChem (CID 125481673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).