C19H23N3 — CID 125482012
(4aR)-3-(2-pyridin-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline (PubChem CID 125482012) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (4aR)-3-(2-pyridin-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline.
| Compound Name | (4aR)-3-(2-pyridin-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline |
|---|---|
| PubChem CID | 125482012 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (4aR)-3-(2-pyridin-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline |
| SMILES | c1ccc(CCN2CCN3c4ccccc4CC[C@@H]3C2)nc1 |
| InChI | InChI=1S/C19H23N3/c1-2-7-19-16(5-1)8-9-18-15-21(13-14-22(18)19)12-10-17-6-3-4-11-20-17/h1-7,11,18H,8-10,12-15H2/t18-/m1/s1 |
| InChIKey | DPWASHUOTZMUQG-GOSISDBHSA-N |
| XLogP | 2.76 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |