About ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate
ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate (PubChem CID 125482052) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate |
| PubChem CID | 125482052 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate |
| SMILES | CCOC(=O)[C@](C)(N)c1cn(C)nc1C |
| InChI | InChI=1S/C10H17N3O2/c1-5-15-9(14)10(3,11)8-6-13(4)12-7(8)2/h6H,5,11H2,1-4H3/t10-/m1/s1 |
| InChIKey | GTEUYOUGXXFZFK-SNVBAGLBSA-N |
| XLogP | 0.47 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate?
The IUPAC name of ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate (CID 125482052) is ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate.
What is the SMILES notation for ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate?
The canonical SMILES for ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate is CCOC(=O)[C@](C)(N)c1cn(C)nc1C.
What is the InChIKey of ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate?
The InChIKey is GTEUYOUGXXFZFK-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-5-15-9(14)10(3,11)8-6-13(4)12-7(8)2/h6H,5,11H2,1-4H3/t10-/m1/s1.
What are the key properties of ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate?
ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate has a molecular weight of 211.26 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate is sourced from PubChem (CID 125482052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).