C10H17N3O2 — CID 125482052
ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate (PubChem CID 125482052) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate.
| Compound Name | ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 125482052 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl (2R)-2-amino-2-(1,3-dimethylpyrazol-4-yl)propanoate |
| SMILES | CCOC(=O)[C@](C)(N)c1cn(C)nc1C |
| InChI | InChI=1S/C10H17N3O2/c1-5-15-9(14)10(3,11)8-6-13(4)12-7(8)2/h6H,5,11H2,1-4H3/t10-/m1/s1 |
| InChIKey | GTEUYOUGXXFZFK-SNVBAGLBSA-N |
| XLogP | 0.47 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |