C18H22IN5O2 — CID 125483083
(3R)-4-hydroxy-N-(3-iodophenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)butanamide (PubChem CID 125483083) has the molecular formula C18H22IN5O2 and a molecular weight of 467.31 g/mol. Its IUPAC name is (3R)-4-hydroxy-N-(3-iodophenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)butanamide.
| Compound Name | (3R)-4-hydroxy-N-(3-iodophenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 125483083 |
| Molecular Formula | C18H22IN5O2 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (3R)-4-hydroxy-N-(3-iodophenyl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)butanamide |
| SMILES | O=C(C[C@H](CO)N1CCN(c2ncccn2)CC1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C18H22IN5O2/c19-14-3-1-4-15(11-14)22-17(26)12-16(13-25)23-7-9-24(10-8-23)18-20-5-2-6-21-18/h1-6,11,16,25H,7-10,12-13H2,(H,22,26)/t16-/m1/s1 |
| InChIKey | XBXCAGFGLAQGFS-MRXNPFEDSA-N |
| XLogP | 1.59 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|