C12H9FO3 — CID 125483362
2-(2-fluorobenzoyl)cyclopentane-1,3-dione (PubChem CID 125483362) has the molecular formula C12H9FO3 and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-(2-fluorobenzoyl)cyclopentane-1,3-dione.
| Compound Name | 2-(2-fluorobenzoyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 125483362 |
| Molecular Formula | C12H9FO3 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(2-fluorobenzoyl)cyclopentane-1,3-dione |
| SMILES | O=C1CCC(=O)C1C(=O)c1ccccc1F |
| InChI | InChI=1S/C12H9FO3/c13-8-4-2-1-3-7(8)12(16)11-9(14)5-6-10(11)15/h1-4,11H,5-6H2 |
| InChIKey | JGMFJHFRCUUFRW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|