C12H13N3OS — CID 125483975
2-(2-methylanilino)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 125483975) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-(2-methylanilino)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-methylanilino)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 125483975 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-(2-methylanilino)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1ccccc1NCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H13N3OS/c1-9-4-2-3-5-10(9)14-8-11(16)15-12-13-6-7-17-12/h2-7,14H,8H2,1H3,(H,13,15,16) |
| InChIKey | OCETXRDBWLYBNI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |