C18H38O4Si — CID 125485807
(2R,3R)-3-[(2R)-2-methyl-2-triethylsilylperoxyheptyl]oxolan-2-ol (PubChem CID 125485807) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (2R,3R)-3-[(2R)-2-methyl-2-triethylsilylperoxyheptyl]oxolan-2-ol.
| Compound Name | (2R,3R)-3-[(2R)-2-methyl-2-triethylsilylperoxyheptyl]oxolan-2-ol |
|---|---|
| PubChem CID | 125485807 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (2R,3R)-3-[(2R)-2-methyl-2-triethylsilylperoxyheptyl]oxolan-2-ol |
| SMILES | CCCCC[C@](C)(C[C@H]1CCO[C@H]1O)OO[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H38O4Si/c1-6-10-11-13-18(5,15-16-12-14-20-17(16)19)21-22-23(7-2,8-3)9-4/h16-17,19H,6-15H2,1-5H3/t16-,17-,18-/m1/s1 |
| InChIKey | DAAIMOKWGSNALR-KZNAEPCWSA-N |
| XLogP | 5.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|