C14H18O3S — CID 125488946
ethyl (2S)-2-acetyl-2-(thiophen-2-ylmethyl)pent-4-enoate (PubChem CID 125488946) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is ethyl (2S)-2-acetyl-2-(thiophen-2-ylmethyl)pent-4-enoate.
| Compound Name | ethyl (2S)-2-acetyl-2-(thiophen-2-ylmethyl)pent-4-enoate |
|---|---|
| PubChem CID | 125488946 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | ethyl (2S)-2-acetyl-2-(thiophen-2-ylmethyl)pent-4-enoate |
| SMILES | C=CC[C@](Cc1cccs1)(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C14H18O3S/c1-4-8-14(11(3)15,13(16)17-5-2)10-12-7-6-9-18-12/h4,6-7,9H,1,5,8,10H2,2-3H3/t14-/m0/s1 |
| InChIKey | TWVKXELNAYREJG-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|