C9H10ClIN2O3 — CID 125490235
N-(2-chloroethoxy)-5-iodo-6-methyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 125490235) has the molecular formula C9H10ClIN2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is N-(2-chloroethoxy)-5-iodo-6-methyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-chloroethoxy)-5-iodo-6-methyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125490235 |
| Molecular Formula | C9H10ClIN2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | N-(2-chloroethoxy)-5-iodo-6-methyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1[nH]c(=O)c(C(=O)NOCCCl)cc1I |
| InChI | InChI=1S/C9H10ClIN2O3/c1-5-7(11)4-6(8(14)12-5)9(15)13-16-3-2-10/h4H,2-3H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | DQGFOICVCOJATG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|