C13H11N3 — CID 125490764
2-phenyl-3H-pyrrolo[2,3-b]pyridin-5-amine (PubChem CID 125490764) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-phenyl-3H-pyrrolo[2,3-b]pyridin-5-amine.
| Compound Name | 2-phenyl-3H-pyrrolo[2,3-b]pyridin-5-amine |
|---|---|
| PubChem CID | 125490764 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-phenyl-3H-pyrrolo[2,3-b]pyridin-5-amine |
| SMILES | Nc1cnc2c(c1)CC(c1ccccc1)=N2 |
| InChI | InChI=1S/C13H11N3/c14-11-6-10-7-12(16-13(10)15-8-11)9-4-2-1-3-5-9/h1-6,8H,7,14H2 |
| InChIKey | JFDXWQAUMSIART-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |