C14H17ClO3 — CID 125490844
(3S)-5,5-dimethyl-3-phenylmethoxyoxolane-3-carbonyl chloride (PubChem CID 125490844) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is (3S)-5,5-dimethyl-3-phenylmethoxyoxolane-3-carbonyl chloride.
| Compound Name | (3S)-5,5-dimethyl-3-phenylmethoxyoxolane-3-carbonyl chloride |
|---|---|
| PubChem CID | 125490844 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (3S)-5,5-dimethyl-3-phenylmethoxyoxolane-3-carbonyl chloride |
| SMILES | CC1(C)C[C@@](OCc2ccccc2)(C(=O)Cl)CO1 |
| InChI | InChI=1S/C14H17ClO3/c1-13(2)9-14(10-18-13,12(15)16)17-8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | QUBQXESVELPRGG-AWEZNQCLSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|