C21H25NO3 — CID 59337560
benzyl (3S)-4-benzyl-6,6-dimethylmorpholine-3-carboxylate (PubChem CID 59337560) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is benzyl (3S)-4-benzyl-6,6-dimethylmorpholine-3-carboxylate.
| Compound Name | benzyl (3S)-4-benzyl-6,6-dimethylmorpholine-3-carboxylate |
|---|---|
| PubChem CID | 59337560 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | benzyl (3S)-4-benzyl-6,6-dimethylmorpholine-3-carboxylate |
| SMILES | CC1(C)CN(Cc2ccccc2)[C@H](C(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2)16-22(13-17-9-5-3-6-10-17)19(15-25-21)20(23)24-14-18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | NGKZRFZBVRGVJR-IBGZPJMESA-N |
| XLogP | 3.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |