C14H20ClNO — CID 155289958
(5R)-4-benzyl-5-(chloromethyl)-2,2-dimethylmorpholine (PubChem CID 155289958) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is (5R)-4-benzyl-5-(chloromethyl)-2,2-dimethylmorpholine.
| Compound Name | (5R)-4-benzyl-5-(chloromethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 155289958 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (5R)-4-benzyl-5-(chloromethyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(Cc2ccccc2)[C@@H](CCl)CO1 |
| InChI | InChI=1S/C14H20ClNO/c1-14(2)11-16(13(8-15)10-17-14)9-12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | FYDYUQRJTBSHOE-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|