C18H22N2O2 — CID 125491409
5,6-diethyl-2-oxo-N-[(1R)-1-phenylethyl]-1H-pyridine-3-carboxamide (PubChem CID 125491409) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5,6-diethyl-2-oxo-N-[(1R)-1-phenylethyl]-1H-pyridine-3-carboxamide.
| Compound Name | 5,6-diethyl-2-oxo-N-[(1R)-1-phenylethyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125491409 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 5,6-diethyl-2-oxo-N-[(1R)-1-phenylethyl]-1H-pyridine-3-carboxamide |
| SMILES | CCc1cc(C(=O)N[C@H](C)c2ccccc2)c(=O)[nH]c1CC |
| InChI | InChI=1S/C18H22N2O2/c1-4-13-11-15(18(22)20-16(13)5-2)17(21)19-12(3)14-9-7-6-8-10-14/h6-12H,4-5H2,1-3H3,(H,19,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | XQRWMZBJICYHSD-GFCCVEGCSA-N |
| XLogP | 2.99 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |