C21H20N2O3 — CID 125491976
methyl 2-[(2S,3R)-1-benzhydryl-2-cyano-5-oxopyrrolidin-3-yl]acetate (PubChem CID 125491976) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 2-[(2S,3R)-1-benzhydryl-2-cyano-5-oxopyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(2S,3R)-1-benzhydryl-2-cyano-5-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 125491976 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl 2-[(2S,3R)-1-benzhydryl-2-cyano-5-oxopyrrolidin-3-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC(=O)N(C(c2ccccc2)c2ccccc2)[C@@H]1C#N |
| InChI | InChI=1S/C21H20N2O3/c1-26-20(25)13-17-12-19(24)23(18(17)14-22)21(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17-18,21H,12-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | TWDJSJZHDSTGOL-QZTJIDSGSA-N |
| XLogP | 3.08 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |