C18H20N2O — CID 125492546
(2S)-2-butyl-3-phenyl-1,2-dihydroquinazolin-4-one (PubChem CID 125492546) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (2S)-2-butyl-3-phenyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-butyl-3-phenyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 125492546 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (2S)-2-butyl-3-phenyl-1,2-dihydroquinazolin-4-one |
| SMILES | CCCC[C@H]1Nc2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c1-2-3-13-17-19-16-12-8-7-11-15(16)18(21)20(17)14-9-5-4-6-10-14/h4-12,17,19H,2-3,13H2,1H3/t17-/m0/s1 |
| InChIKey | RFZKFWIJMGKYSQ-KRWDZBQOSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |