C12H16 — CID 125492551
(4S)-4-[(1E,3E)-hexa-1,3,5-trienyl]cyclohexene (PubChem CID 125492551) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (4S)-4-[(1E,3E)-hexa-1,3,5-trienyl]cyclohexene.
| Compound Name | (4S)-4-[(1E,3E)-hexa-1,3,5-trienyl]cyclohexene |
|---|---|
| PubChem CID | 125492551 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (4S)-4-[(1E,3E)-hexa-1,3,5-trienyl]cyclohexene |
| SMILES | C=C/C=C/C=C/[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C12H16/c1-2-3-4-6-9-12-10-7-5-8-11-12/h2-7,9,12H,1,8,10-11H2/b4-3+,9-6+/t12-/m1/s1 |
| InChIKey | RYROCDYMUXRQSR-LGXMIVFISA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|