C17H20O — CID 134996516
1-[(1E,3E)-4-cyclohex-3-en-1-ylbuta-1,3-dienyl]-4-methoxybenzene (PubChem CID 134996516) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[(1E,3E)-4-cyclohex-3-en-1-ylbuta-1,3-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(1E,3E)-4-cyclohex-3-en-1-ylbuta-1,3-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 134996516 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-[(1E,3E)-4-cyclohex-3-en-1-ylbuta-1,3-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C=C/C=C/C2CC=CCC2)cc1 |
| InChI | InChI=1S/C17H20O/c1-18-17-13-11-16(12-14-17)10-6-5-9-15-7-3-2-4-8-15/h2-3,5-6,9-15H,4,7-8H2,1H3/b9-5+,10-6+ |
| InChIKey | ZXZSYPOFGNUBNE-NXZHAISVSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|