C15H25ClN4O2 — CID 125495061
2-[4-chloro-6-(2-methylbutan-2-ylamino)-2-morpholin-4-ylpyrimidin-5-yl]ethanol (PubChem CID 125495061) has the molecular formula C15H25ClN4O2 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-[4-chloro-6-(2-methylbutan-2-ylamino)-2-morpholin-4-ylpyrimidin-5-yl]ethanol.
| Compound Name | 2-[4-chloro-6-(2-methylbutan-2-ylamino)-2-morpholin-4-ylpyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 125495061 |
| Molecular Formula | C15H25ClN4O2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[4-chloro-6-(2-methylbutan-2-ylamino)-2-morpholin-4-ylpyrimidin-5-yl]ethanol |
| SMILES | CCC(C)(C)Nc1nc(N2CCOCC2)nc(Cl)c1CCO |
| InChI | InChI=1S/C15H25ClN4O2/c1-4-15(2,3)19-13-11(5-8-21)12(16)17-14(18-13)20-6-9-22-10-7-20/h21H,4-10H2,1-3H3,(H,17,18,19) |
| InChIKey | JCQXTRPFKIXDBQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |