C9H14N2OS2 — CID 125495336
6-(1-methylimidazol-2-yl)-1,4-dithiepan-6-ol (PubChem CID 125495336) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 6-(1-methylimidazol-2-yl)-1,4-dithiepan-6-ol.
| Compound Name | 6-(1-methylimidazol-2-yl)-1,4-dithiepan-6-ol |
|---|---|
| PubChem CID | 125495336 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 6-(1-methylimidazol-2-yl)-1,4-dithiepan-6-ol |
| SMILES | Cn1ccnc1C1(O)CSCCSC1 |
| InChI | InChI=1S/C9H14N2OS2/c1-11-3-2-10-8(11)9(12)6-13-4-5-14-7-9/h2-3,12H,4-7H2,1H3 |
| InChIKey | UFHMOMFSKDHELE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |