About trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol
trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol (PubChem CID 154850428) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol |
| PubChem CID | 154850428 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol |
| SMILES | Cn1ccnc1[C@@]1(O)CCC[C@H](N)C1 |
| InChI | InChI=1S/C10H17N3O/c1-13-6-5-12-9(13)10(14)4-2-3-8(11)7-10/h5-6,8,14H,2-4,7,11H2,1H3/t8-,10+/m0/s1 |
| InChIKey | IDGMTYMIAMKTIR-WCBMZHEXSA-N |
| XLogP | 0.51 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol?
The IUPAC name of trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol (CID 154850428) is trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol?
The canonical SMILES for trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol is Cn1ccnc1[C@@]1(O)CCC[C@H](N)C1.
What is the InChIKey of trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol?
The InChIKey is IDGMTYMIAMKTIR-WCBMZHEXSA-N. The full InChI is InChI=1S/C10H17N3O/c1-13-6-5-12-9(13)10(14)4-2-3-8(11)7-10/h5-6,8,14H,2-4,7,11H2,1H3/t8-,10+/m0/s1.
What are the key properties of trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol?
trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol has a molecular weight of 195.27 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3S)-3-amino-1-(1-methylimidazol-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 154850428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).