C10H17N3O — CID 80562581
3-amino-1-[(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol (PubChem CID 80562581) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-amino-1-[(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol.
| Compound Name | 3-amino-1-[(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 80562581 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-amino-1-[(1-methylimidazol-2-yl)methyl]cyclopentan-1-ol |
| SMILES | Cn1ccnc1CC1(O)CCC(N)C1 |
| InChI | InChI=1S/C10H17N3O/c1-13-5-4-12-9(13)7-10(14)3-2-8(11)6-10/h4-5,8,14H,2-3,6-7,11H2,1H3 |
| InChIKey | VUJXKEAKRUVONK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |