C17H34BrO7P — CID 125496986
[(2R)-1-[2-bromoethoxy(hydroxy)phosphoryl]oxy-3-decoxypropan-2-yl] acetate (PubChem CID 125496986) has the molecular formula C17H34BrO7P and a molecular weight of 461.33 g/mol. Its IUPAC name is [(2R)-1-[2-bromoethoxy(hydroxy)phosphoryl]oxy-3-decoxypropan-2-yl] acetate.
| Compound Name | [(2R)-1-[2-bromoethoxy(hydroxy)phosphoryl]oxy-3-decoxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 125496986 |
| Molecular Formula | C17H34BrO7P |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [(2R)-1-[2-bromoethoxy(hydroxy)phosphoryl]oxy-3-decoxypropan-2-yl] acetate |
| SMILES | CCCCCCCCCCOC[C@H](COP(=O)(O)OCCBr)OC(C)=O |
| InChI | InChI=1S/C17H34BrO7P/c1-3-4-5-6-7-8-9-10-12-22-14-17(25-16(2)19)15-24-26(20,21)23-13-11-18/h17H,3-15H2,1-2H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | LMSCUAIXPUXKRG-QGZVFWFLSA-N |
| XLogP | 4.60 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|