2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate

C21H44BrO6P — CID 10323811

IUPAC2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate
SMILESCCCCC(CCCC)CCCCCCOCC(COP(=O)(O)OCCBr)OC
InChIInChI=1S/C21H44BrO6P/c1-4-6-12-20(13-7-5-2)14-10-8-9-11-16-26-18-21(25-3)19-28-29(23,24)27-17-15-22/h20-21H,4-19H2,1-3H3,(H,23,24)
InChIKeyXEAMBSKMWMXUBV-UHFFFAOYSA-N
MW503.46 g/mol
LogP6.49
Rot. Bonds22

About 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate

2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate (PubChem CID 10323811) has the molecular formula C21H44BrO6P and a molecular weight of 503.46 g/mol. Its IUPAC name is 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate.

Molecular Properties

Compound Name2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate
PubChem CID10323811
Molecular FormulaC21H44BrO6P
Molecular Weight503.46 g/mol
Exact Mass502.21
IUPAC Name2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate
SMILESCCCCC(CCCC)CCCCCCOCC(COP(=O)(O)OCCBr)OC
InChIInChI=1S/C21H44BrO6P/c1-4-6-12-20(13-7-5-2)14-10-8-9-11-16-26-18-21(25-3)19-28-29(23,24)27-17-15-22/h20-21H,4-19H2,1-3H3,(H,23,24)
InChIKeyXEAMBSKMWMXUBV-UHFFFAOYSA-N
XLogP6.49
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds22
Heavy Atoms29
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500503.46
LogP ≤ 56.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate?
The IUPAC name of 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate (CID 10323811) is 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate.
What is the SMILES notation for 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate?
The canonical SMILES for 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate is CCCCC(CCCC)CCCCCCOCC(COP(=O)(O)OCCBr)OC.
What is the InChIKey of 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate?
The InChIKey is XEAMBSKMWMXUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44BrO6P/c1-4-6-12-20(13-7-5-2)14-10-8-9-11-16-26-18-21(25-3)19-28-29(23,24)27-17-15-22/h20-21H,4-19H2,1-3H3,(H,23,24).
What are the key properties of 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate?
2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate has a molecular weight of 503.46 g/mol, XLogP of 6.49, 22 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate is sourced from PubChem (CID 10323811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).