C21H44BrO6P — CID 10323811
2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate (PubChem CID 10323811) has the molecular formula C21H44BrO6P and a molecular weight of 503.46 g/mol. Its IUPAC name is 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate.
| Compound Name | 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 10323811 |
| Molecular Formula | C21H44BrO6P |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2-bromoethyl [3-(7-butylundecoxy)-2-methoxypropyl] hydrogen phosphate |
| SMILES | CCCCC(CCCC)CCCCCCOCC(COP(=O)(O)OCCBr)OC |
| InChI | InChI=1S/C21H44BrO6P/c1-4-6-12-20(13-7-5-2)14-10-8-9-11-16-26-18-21(25-3)19-28-29(23,24)27-17-15-22/h20-21H,4-19H2,1-3H3,(H,23,24) |
| InChIKey | XEAMBSKMWMXUBV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|