C26H56NO6P — CID 54514426
[2-methoxy-3-(7,11,15-trimethylhexadecoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate (PubChem CID 54514426) has the molecular formula C26H56NO6P and a molecular weight of 509.71 g/mol. Its IUPAC name is [2-methoxy-3-(7,11,15-trimethylhexadecoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate.
| Compound Name | [2-methoxy-3-(7,11,15-trimethylhexadecoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 54514426 |
| Molecular Formula | C26H56NO6P |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.38 |
| IUPAC Name | [2-methoxy-3-(7,11,15-trimethylhexadecoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate |
| SMILES | CNCCOP(=O)(O)OCC(COCCCCCCC(C)CCCC(C)CCCC(C)C)OC |
| InChI | InChI=1S/C26H56NO6P/c1-23(2)13-11-15-25(4)17-12-16-24(3)14-9-7-8-10-19-31-21-26(30-6)22-33-34(28,29)32-20-18-27-5/h23-27H,7-22H2,1-6H3,(H,28,29) |
| InChIKey | YLKLPHXKQYGMMC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|