C22H42NO6P — CID 54338499
[2-methoxy-3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate (PubChem CID 54338499) has the molecular formula C22H42NO6P and a molecular weight of 447.55 g/mol. Its IUPAC name is [2-methoxy-3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate.
| Compound Name | [2-methoxy-3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 54338499 |
| Molecular Formula | C22H42NO6P |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | [2-methoxy-3-(3,7,11-trimethyldodeca-2,6,10-trienoxy)propyl] 2-(methylamino)ethyl hydrogen phosphate |
| SMILES | CNCCOP(=O)(O)OCC(COCC=C(C)CCC=C(C)CCC=C(C)C)OC |
| InChI | InChI=1S/C22H42NO6P/c1-19(2)9-7-10-20(3)11-8-12-21(4)13-15-27-17-22(26-6)18-29-30(24,25)28-16-14-23-5/h9,11,13,22-23H,7-8,10,12,14-18H2,1-6H3,(H,24,25) |
| InChIKey | TXFXBZOXHIYIRR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|