C26H54NO6P — CID 54092306
(2-methoxy-3-nonadec-9-enoxypropyl) 2-(methylamino)ethyl hydrogen phosphate (PubChem CID 54092306) has the molecular formula C26H54NO6P and a molecular weight of 507.69 g/mol. Its IUPAC name is (2-methoxy-3-nonadec-9-enoxypropyl) 2-(methylamino)ethyl hydrogen phosphate.
| Compound Name | (2-methoxy-3-nonadec-9-enoxypropyl) 2-(methylamino)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 54092306 |
| Molecular Formula | C26H54NO6P |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | (2-methoxy-3-nonadec-9-enoxypropyl) 2-(methylamino)ethyl hydrogen phosphate |
| SMILES | CCCCCCCCCC=CCCCCCCCCOCC(COP(=O)(O)OCCNC)OC |
| InChI | InChI=1S/C26H54NO6P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-31-24-26(30-3)25-33-34(28,29)32-23-21-27-2/h12-13,26-27H,4-11,14-25H2,1-3H3,(H,28,29) |
| InChIKey | MUSFLKIARKLZLN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|