C19H19Cl3F3N3O2 — CID 125497160
1-ethyl-3-[[4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]urea (PubChem CID 125497160) has the molecular formula C19H19Cl3F3N3O2 and a molecular weight of 484.73 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]urea |
|---|---|
| PubChem CID | 125497160 |
| Molecular Formula | C19H19Cl3F3N3O2 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 1-ethyl-3-[[4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccc(NC[C@](O)(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19Cl3F3N3O2/c1-2-26-17(29)27-9-11-3-5-13(6-4-11)28-10-18(30,19(23,24)25)12-7-14(20)16(22)15(21)8-12/h3-8,28,30H,2,9-10H2,1H3,(H2,26,27,29)/t18-/m0/s1 |
| InChIKey | DJFHYFDNIGMMHK-SFHVURJKSA-N |
| XLogP | 5.33 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|