C19H15Cl3F6N2O2 — CID 125497346
3,3,3-trifluoro-N-[[4-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]propanamide (PubChem CID 125497346) has the molecular formula C19H15Cl3F6N2O2 and a molecular weight of 523.69 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[[4-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[[4-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 125497346 |
| Molecular Formula | C19H15Cl3F6N2O2 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 3,3,3-trifluoro-N-[[4-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-(3,4,5-trichlorophenyl)propyl]amino]phenyl]methyl]propanamide |
| SMILES | O=C(CC(F)(F)F)NCc1ccc(NC[C@@](O)(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15Cl3F6N2O2/c20-13-5-11(6-14(21)16(13)22)17(32,19(26,27)28)9-30-12-3-1-10(2-4-12)8-29-15(31)7-18(23,24)25/h1-6,30,32H,7-9H2,(H,29,31)/t17-/m1/s1 |
| InChIKey | HWCFYKHNETVSMN-QGZVFWFLSA-N |
| XLogP | 6.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|