C21H14Cl2F12N2O2 — CID 125498377
N-[[4-[[(2S)-2-[3,4-dichloro-5-(trifluoromethyl)phenyl]-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-(trifluoromethyl)phenyl]methyl]-3,3,3-trifluoropropanamide (PubChem CID 125498377) has the molecular formula C21H14Cl2F12N2O2 and a molecular weight of 625.24 g/mol. Its IUPAC name is N-[[4-[[(2S)-2-[3,4-dichloro-5-(trifluoromethyl)phenyl]-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-(trifluoromethyl)phenyl]methyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[[4-[[(2S)-2-[3,4-dichloro-5-(trifluoromethyl)phenyl]-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-(trifluoromethyl)phenyl]methyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 125498377 |
| Molecular Formula | C21H14Cl2F12N2O2 |
| Molecular Weight | 625.24 g/mol |
| Exact Mass | 624.02 |
| IUPAC Name | N-[[4-[[(2S)-2-[3,4-dichloro-5-(trifluoromethyl)phenyl]-3,3,3-trifluoro-2-hydroxypropyl]amino]-2-(trifluoromethyl)phenyl]methyl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)NCc1ccc(NC[C@@](O)(c2cc(Cl)c(Cl)c(C(F)(F)F)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H14Cl2F12N2O2/c22-14-4-10(3-13(16(14)23)20(30,31)32)17(39,21(33,34)35)8-37-11-2-1-9(12(5-11)19(27,28)29)7-36-15(38)6-18(24,25)26/h1-5,37,39H,6-8H2,(H,36,38)/t17-/m1/s1 |
| InChIKey | BMDRSHJYZHRUSV-QGZVFWFLSA-N |
| XLogP | 7.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.24 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |