C17H13Cl3F6N2O — CID 125498097
(2R)-3-[4-(aminomethyl)-3-(trifluoromethyl)anilino]-1,1,1-trifluoro-2-(3,4,5-trichlorophenyl)propan-2-ol (PubChem CID 125498097) has the molecular formula C17H13Cl3F6N2O and a molecular weight of 481.65 g/mol. Its IUPAC name is (2R)-3-[4-(aminomethyl)-3-(trifluoromethyl)anilino]-1,1,1-trifluoro-2-(3,4,5-trichlorophenyl)propan-2-ol.
| Compound Name | (2R)-3-[4-(aminomethyl)-3-(trifluoromethyl)anilino]-1,1,1-trifluoro-2-(3,4,5-trichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 125498097 |
| Molecular Formula | C17H13Cl3F6N2O |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | (2R)-3-[4-(aminomethyl)-3-(trifluoromethyl)anilino]-1,1,1-trifluoro-2-(3,4,5-trichlorophenyl)propan-2-ol |
| SMILES | NCc1ccc(NC[C@](O)(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13Cl3F6N2O/c18-12-3-9(4-13(19)14(12)20)15(29,17(24,25)26)7-28-10-2-1-8(6-27)11(5-10)16(21,22)23/h1-5,28-29H,6-7,27H2/t15-/m0/s1 |
| InChIKey | XPSOKGNEUDBYRE-HNNXBMFYSA-N |
| XLogP | 5.99 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|