C20H19ClFN3O — CID 1254989
3-(3-chloro-4-fluorophenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one (PubChem CID 1254989) has the molecular formula C20H19ClFN3O and a molecular weight of 371.84 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one.
| Compound Name | 3-(3-chloro-4-fluorophenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 1254989 |
| Molecular Formula | C20H19ClFN3O |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one |
| SMILES | O=C1/C(=N\c2ccc(F)c(Cl)c2)c2ccccc2N1CN1CCCCC1 |
| InChI | InChI=1S/C20H19ClFN3O/c21-16-12-14(8-9-17(16)22)23-19-15-6-2-3-7-18(15)25(20(19)26)13-24-10-4-1-5-11-24/h2-3,6-9,12H,1,4-5,10-11,13H2/b23-19- |
| InChIKey | SHMRTHWVJIGPCV-NMWGTECJSA-N |
| XLogP | 4.39 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|