C20H19ClN2O — CID 14575197
(3Z)-1-(3-chlorophenyl)-3-(piperidin-1-ylmethylidene)indol-2-one (PubChem CID 14575197) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is (3Z)-1-(3-chlorophenyl)-3-(piperidin-1-ylmethylidene)indol-2-one.
| Compound Name | (3Z)-1-(3-chlorophenyl)-3-(piperidin-1-ylmethylidene)indol-2-one |
|---|---|
| PubChem CID | 14575197 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (3Z)-1-(3-chlorophenyl)-3-(piperidin-1-ylmethylidene)indol-2-one |
| SMILES | O=C1/C(=C\N2CCCCC2)c2ccccc2N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClN2O/c21-15-7-6-8-16(13-15)23-19-10-3-2-9-17(19)18(20(23)24)14-22-11-4-1-5-12-22/h2-3,6-10,13-14H,1,4-5,11-12H2/b18-14- |
| InChIKey | PEEIBFGKWVEZIN-JXAWBTAJSA-N |
| XLogP | 4.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|