About O-phenyl N-pyridin-3-ylcarbamothioate
O-phenyl N-pyridin-3-ylcarbamothioate (PubChem CID 125499505) has the molecular formula C12H10N2OS
and a molecular weight of 230.29 g/mol. Its IUPAC name is O-phenyl N-pyridin-3-ylcarbamothioate.
Molecular Properties
| Compound Name | O-phenyl N-pyridin-3-ylcarbamothioate |
| PubChem CID | 125499505 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | O-phenyl N-pyridin-3-ylcarbamothioate |
| SMILES | S=C(Nc1cccnc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H10N2OS/c16-12(14-10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H,(H,14,16) |
| InChIKey | KKXMEMXGFQMSGX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-phenyl N-pyridin-3-ylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenyl N-pyridin-3-ylcarbamothioate?
The IUPAC name of O-phenyl N-pyridin-3-ylcarbamothioate (CID 125499505) is O-phenyl N-pyridin-3-ylcarbamothioate.
What is the SMILES notation for O-phenyl N-pyridin-3-ylcarbamothioate?
The canonical SMILES for O-phenyl N-pyridin-3-ylcarbamothioate is S=C(Nc1cccnc1)Oc1ccccc1.
What is the InChIKey of O-phenyl N-pyridin-3-ylcarbamothioate?
The InChIKey is KKXMEMXGFQMSGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2OS/c16-12(14-10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H,(H,14,16).
What are the key properties of O-phenyl N-pyridin-3-ylcarbamothioate?
O-phenyl N-pyridin-3-ylcarbamothioate has a molecular weight of 230.29 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenyl N-pyridin-3-ylcarbamothioate is sourced from PubChem (CID 125499505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).