About 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one
3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 12551289) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 12551289 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | COC1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C9H14O3/c1-9(2)4-6(10)8(12-3)7(11)5-9/h10H,4-5H2,1-3H3 |
| InChIKey | FAEIQRZJRGIIQH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one (CID 12551289) is 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one is COC1=C(O)CC(C)(C)CC1=O.
What is the InChIKey of 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is FAEIQRZJRGIIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-9(2)4-6(10)8(12-3)7(11)5-9/h10H,4-5H2,1-3H3.
What are the key properties of 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one?
3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 170.21 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-methoxy-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 12551289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).