C17H17NO2 — CID 12554497
ethyl 2,5-dimethyl-4-(2-phenylethynyl)-1H-pyrrole-3-carboxylate (PubChem CID 12554497) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-4-(2-phenylethynyl)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-4-(2-phenylethynyl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 12554497 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | ethyl 2,5-dimethyl-4-(2-phenylethynyl)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1C#Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-4-20-17(19)16-13(3)18-12(2)15(16)11-10-14-8-6-5-7-9-14/h5-9,18H,4H2,1-3H3 |
| InChIKey | ACNJCEFHPXMTDX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|