C19H25N7O7S — CID 12554751
2-tert-butyl-1-(2-ethoxyquinolin-4-yl)-3-(1,3-thiazol-2-yl)guanidine;bis(nitric acid) (PubChem CID 12554751) has the molecular formula C19H25N7O7S and a molecular weight of 495.52 g/mol. Its IUPAC name is 2-tert-butyl-1-(2-ethoxyquinolin-4-yl)-3-(1,3-thiazol-2-yl)guanidine;bis(nitric acid).
| Compound Name | 2-tert-butyl-1-(2-ethoxyquinolin-4-yl)-3-(1,3-thiazol-2-yl)guanidine;bis(nitric acid) |
|---|---|
| PubChem CID | 12554751 |
| Molecular Formula | C19H25N7O7S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-tert-butyl-1-(2-ethoxyquinolin-4-yl)-3-(1,3-thiazol-2-yl)guanidine;bis(nitric acid) |
| SMILES | CCOc1cc(N/C(=N/C(C)(C)C)Nc2nccs2)c2ccccc2n1.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C19H23N5OS.2HNO3/c1-5-25-16-12-15(13-8-6-7-9-14(13)21-16)22-17(24-19(2,3)4)23-18-20-10-11-26-18;2*2-1(3)4/h6-12H,5H2,1-4H3,(H2,20,21,22,23,24);2*(H,2,3,4) |
| InChIKey | ZSIGFSNAPPLMBF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 198.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|