C23H32N6O3S — CID 162419261
tert-butyl N-[5-[2-[[7-[3-(dimethylamino)propoxy]quinazolin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 162419261) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[[7-[3-(dimethylamino)propoxy]quinazolin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[[7-[3-(dimethylamino)propoxy]quinazolin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 162419261 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl N-[5-[2-[[7-[3-(dimethylamino)propoxy]quinazolin-4-yl]amino]ethyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CN(C)CCCOc1ccc2c(NCCc3cnc(NC(=O)OC(C)(C)C)s3)ncnc2c1 |
| InChI | InChI=1S/C23H32N6O3S/c1-23(2,3)32-22(30)28-21-25-14-17(33-21)9-10-24-20-18-8-7-16(13-19(18)26-15-27-20)31-12-6-11-29(4)5/h7-8,13-15H,6,9-12H2,1-5H3,(H,24,26,27)(H,25,28,30) |
| InChIKey | QZBRHWBWGVWMJS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|