C17H9F2N3O2S2 — CID 1255762
(5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 1255762) has the molecular formula C17H9F2N3O2S2 and a molecular weight of 389.41 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1255762 |
| Molecular Formula | C17H9F2N3O2S2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (5Z)-5-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3ccc(F)cc3F)o2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C17H9F2N3O2S2/c18-9-1-3-11(12(19)7-9)13-4-2-10(24-13)8-14-15(23)22(16(20)26-14)17-21-5-6-25-17/h1-8,20H/b14-8-,20-16- |
| InChIKey | RZQXBOVCRYBWPJ-JWQHHXQUSA-N |
| XLogP | 4.74 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|