C10H25N2O2P — CID 12565361
bis[(tert-butylamino)methyl]phosphinic acid (PubChem CID 12565361) has the molecular formula C10H25N2O2P and a molecular weight of 236.30 g/mol. Its IUPAC name is bis[(tert-butylamino)methyl]phosphinic acid.
| Compound Name | bis[(tert-butylamino)methyl]phosphinic acid |
|---|---|
| PubChem CID | 12565361 |
| Molecular Formula | C10H25N2O2P |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | bis[(tert-butylamino)methyl]phosphinic acid |
| SMILES | CC(C)(C)NCP(=O)(O)CNC(C)(C)C |
| InChI | InChI=1S/C10H25N2O2P/c1-9(2,3)11-7-15(13,14)8-12-10(4,5)6/h11-12H,7-8H2,1-6H3,(H,13,14) |
| InChIKey | GJUVPPMXADSWIR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|