About trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane
trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane (PubChem CID 12566350) has the molecular formula C11H15Cl3OSi
and a molecular weight of 297.69 g/mol. Its IUPAC name is trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane.
Molecular Properties
| Compound Name | trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane |
| PubChem CID | 12566350 |
| Molecular Formula | C11H15Cl3OSi |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H15Cl3OSi/c1-16(2,3)15-10(11(12,13)14)9-7-5-4-6-8-9/h4-8,10H,1-3H3 |
| InChIKey | XMHCCYACBVLCPF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane?
The IUPAC name of trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane (CID 12566350) is trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane.
What is the SMILES notation for trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane?
The canonical SMILES for trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane is C[Si](C)(C)OC(c1ccccc1)C(Cl)(Cl)Cl.
What is the InChIKey of trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane?
The InChIKey is XMHCCYACBVLCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl3OSi/c1-16(2,3)15-10(11(12,13)14)9-7-5-4-6-8-9/h4-8,10H,1-3H3.
What are the key properties of trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane?
trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane has a molecular weight of 297.69 g/mol, XLogP of 4.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2,2,2-trichloro-1-phenylethoxy)silane is sourced from PubChem (CID 12566350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).