C8H12O5 — CID 12567702
diethyl oxirane-2,3-dicarboxylate (PubChem CID 12567702) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is diethyl oxirane-2,3-dicarboxylate.
| Compound Name | diethyl oxirane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 12567702 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | diethyl oxirane-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1OC1C(=O)OCC |
| InChI | InChI=1S/C8H12O5/c1-3-11-7(9)5-6(13-5)8(10)12-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | LDFQMMUIJQDSAB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|