C23H20N4O2 — CID 12568896
N-(4,5-diphenyltriazol-1-yl)-2-(4-methoxyphenyl)acetamide (PubChem CID 12568896) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(4,5-diphenyltriazol-1-yl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-(4,5-diphenyltriazol-1-yl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 12568896 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-(4,5-diphenyltriazol-1-yl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nn2nnc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c1-29-20-14-12-17(13-15-20)16-21(28)25-27-23(19-10-6-3-7-11-19)22(24-26-27)18-8-4-2-5-9-18/h2-15H,16H2,1H3,(H,25,28) |
| InChIKey | PGSLYCCTGWFGMA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |