C21H14N2O6 — CID 1256918
[4-[(4S)-2-amino-3-cyano-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-4-yl]phenyl] furan-2-carboxylate (PubChem CID 1256918) has the molecular formula C21H14N2O6 and a molecular weight of 390.35 g/mol. Its IUPAC name is [4-[(4S)-2-amino-3-cyano-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-4-yl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(4S)-2-amino-3-cyano-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-4-yl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1256918 |
| Molecular Formula | C21H14N2O6 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [4-[(4S)-2-amino-3-cyano-7-methyl-5-oxo-4H-pyrano[3,2-c]pyran-4-yl]phenyl] furan-2-carboxylate |
| SMILES | Cc1cc2c(c(=O)o1)[C@@H](c1ccc(OC(=O)c3ccco3)cc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C21H14N2O6/c1-11-9-16-18(21(25)27-11)17(14(10-22)19(23)29-16)12-4-6-13(7-5-12)28-20(24)15-3-2-8-26-15/h2-9,17H,23H2,1H3/t17-/m0/s1 |
| InChIKey | RMXUALAAIXTJIT-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|